C8H14N2O3S — CID 170359660
2-[(2-methylsulfanylacetyl)amino]-N-(2-oxopropyl)acetamide (PubChem CID 170359660) has the molecular formula C8H14N2O3S and a molecular weight of 218.28 g/mol. Its IUPAC name is 2-[(2-methylsulfanylacetyl)amino]-N-(2-oxopropyl)acetamide.
| Compound Name | 2-[(2-methylsulfanylacetyl)amino]-N-(2-oxopropyl)acetamide |
|---|---|
| PubChem CID | 170359660 |
| Molecular Formula | C8H14N2O3S |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-[(2-methylsulfanylacetyl)amino]-N-(2-oxopropyl)acetamide |
| SMILES | CSCC(=O)NCC(=O)NCC(C)=O |
| InChI | InChI=1S/C8H14N2O3S/c1-6(11)3-9-7(12)4-10-8(13)5-14-2/h3-5H2,1-2H3,(H,9,12)(H,10,13) |
| InChIKey | YIULCLWOZKTFCZ-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |