C12H20N2O4 — CID 91024658
3,4-dimethyl-2-oxo-N-[2-oxo-2-(2-oxopropylamino)ethyl]pentanamide (PubChem CID 91024658) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 3,4-dimethyl-2-oxo-N-[2-oxo-2-(2-oxopropylamino)ethyl]pentanamide.
| Compound Name | 3,4-dimethyl-2-oxo-N-[2-oxo-2-(2-oxopropylamino)ethyl]pentanamide |
|---|---|
| PubChem CID | 91024658 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 3,4-dimethyl-2-oxo-N-[2-oxo-2-(2-oxopropylamino)ethyl]pentanamide |
| SMILES | CC(=O)CNC(=O)CNC(=O)C(=O)C(C)C(C)C |
| InChI | InChI=1S/C12H20N2O4/c1-7(2)9(4)11(17)12(18)14-6-10(16)13-5-8(3)15/h7,9H,5-6H2,1-4H3,(H,13,16)(H,14,18) |
| InChIKey | RBPLTZDJCYAJLR-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|