C14H26N2O5 — CID 144872534
ethane;4-oxo-4-[[2-oxo-2-(5-oxohexylamino)ethyl]amino]butanoic acid (PubChem CID 144872534) has the molecular formula C14H26N2O5 and a molecular weight of 302.37 g/mol. Its IUPAC name is ethane;4-oxo-4-[[2-oxo-2-(5-oxohexylamino)ethyl]amino]butanoic acid.
| Compound Name | ethane;4-oxo-4-[[2-oxo-2-(5-oxohexylamino)ethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 144872534 |
| Molecular Formula | C14H26N2O5 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | ethane;4-oxo-4-[[2-oxo-2-(5-oxohexylamino)ethyl]amino]butanoic acid |
| SMILES | CC.CC(=O)CCCCNC(=O)CNC(=O)CCC(=O)O |
| InChI | InChI=1S/C12H20N2O5.C2H6/c1-9(15)4-2-3-7-13-11(17)8-14-10(16)5-6-12(18)19;1-2/h2-8H2,1H3,(H,13,17)(H,14,16)(H,18,19);1-2H3 |
| InChIKey | YVESBDUDTLRSLB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|