C28H32N4O — CID 170360618
5,9-bis[(4-methylphenyl)methyl]spiro[1,5,9,11-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),10-diene-13,1'-cyclopropane]-8-one (PubChem CID 170360618) has the molecular formula C28H32N4O and a molecular weight of 440.59 g/mol. Its IUPAC name is 5,9-bis[(4-methylphenyl)methyl]spiro[1,5,9,11-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),10-diene-13,1'-cyclopropane]-8-one.
| Compound Name | 5,9-bis[(4-methylphenyl)methyl]spiro[1,5,9,11-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),10-diene-13,1'-cyclopropane]-8-one |
|---|---|
| PubChem CID | 170360618 |
| Molecular Formula | C28H32N4O |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 5,9-bis[(4-methylphenyl)methyl]spiro[1,5,9,11-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),10-diene-13,1'-cyclopropane]-8-one |
| SMILES | Cc1ccc(CN2CCC3=C(C2)C(=O)N(Cc2ccc(C)cc2)C2=NCC4(CC4)CN23)cc1 |
| InChI | InChI=1S/C28H32N4O/c1-20-3-7-22(8-4-20)15-30-14-11-25-24(17-30)26(33)31(16-23-9-5-21(2)6-10-23)27-29-18-28(12-13-28)19-32(25)27/h3-10H,11-19H2,1-2H3 |
| InChIKey | LZVQQZMYIVJVLZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 39.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |