C16H19FIN3O3S — CID 170360778
(1S,2S,3R,4S)-N-[3-(1-fluoro-1-iodoethyl)sulfonylphenyl]-3-hydrazinylbicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 170360778) has the molecular formula C16H19FIN3O3S and a molecular weight of 479.32 g/mol. Its IUPAC name is (1S,2S,3R,4S)-N-[3-(1-fluoro-1-iodoethyl)sulfonylphenyl]-3-hydrazinylbicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,2S,3R,4S)-N-[3-(1-fluoro-1-iodoethyl)sulfonylphenyl]-3-hydrazinylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 170360778 |
| Molecular Formula | C16H19FIN3O3S |
| Molecular Weight | 479.32 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | (1S,2S,3R,4S)-N-[3-(1-fluoro-1-iodoethyl)sulfonylphenyl]-3-hydrazinylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CC(F)(I)S(=O)(=O)c1cccc(NC(=O)[C@@H]2[C@H](NN)[C@@H]3C=C[C@@H]2C3)c1 |
| InChI | InChI=1S/C16H19FIN3O3S/c1-16(17,18)25(23,24)12-4-2-3-11(8-12)20-15(22)13-9-5-6-10(7-9)14(13)21-19/h2-6,8-10,13-14,21H,7,19H2,1H3,(H,20,22)/t9-,10-,13+,14-,16?/m1/s1 |
| InChIKey | WOJSXISNJLOPOF-RJIZYSLXSA-N |
| XLogP | 2.13 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|