C20H23F3N2O3S — CID 163395839
tert-butyl N-[(1R,2R,3S,4S)-3-[[3-(trifluoromethylsulfanyl)phenyl]carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamate (PubChem CID 163395839) has the molecular formula C20H23F3N2O3S and a molecular weight of 428.48 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,3S,4S)-3-[[3-(trifluoromethylsulfanyl)phenyl]carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,3S,4S)-3-[[3-(trifluoromethylsulfanyl)phenyl]carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamate |
|---|---|
| PubChem CID | 163395839 |
| Molecular Formula | C20H23F3N2O3S |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | tert-butyl N-[(1R,2R,3S,4S)-3-[[3-(trifluoromethylsulfanyl)phenyl]carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1[C@@H](C(=O)Nc2cccc(SC(F)(F)F)c2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C20H23F3N2O3S/c1-19(2,3)28-18(27)25-16-12-8-7-11(9-12)15(16)17(26)24-13-5-4-6-14(10-13)29-20(21,22)23/h4-8,10-12,15-16H,9H2,1-3H3,(H,24,26)(H,25,27)/t11-,12+,15+,16-/m1/s1 |
| InChIKey | KGUIURZVHFZTGH-GUYJKWIASA-N |
| XLogP | 4.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|