C19H23FN2O3 — CID 24807795
tert-butyl N-[(1S,4R)-3-[(4-fluorophenyl)carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamate (PubChem CID 24807795) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is tert-butyl N-[(1S,4R)-3-[(4-fluorophenyl)carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S,4R)-3-[(4-fluorophenyl)carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamate |
|---|---|
| PubChem CID | 24807795 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | tert-butyl N-[(1S,4R)-3-[(4-fluorophenyl)carbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C(C(=O)Nc2ccc(F)cc2)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C19H23FN2O3/c1-19(2,3)25-18(24)22-16-12-5-4-11(10-12)15(16)17(23)21-14-8-6-13(20)7-9-14/h4-9,11-12,15-16H,10H2,1-3H3,(H,21,23)(H,22,24)/t11-,12+,15?,16?/m0/s1 |
| InChIKey | XCXIITANTXFPIJ-YNQUZJHLSA-N |
| XLogP | 3.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|