C19H30N2O3 — CID 167111093
tert-butyl N-[3-[(1-methylcyclobutyl)methylcarbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamate (PubChem CID 167111093) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl N-[3-[(1-methylcyclobutyl)methylcarbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamate.
| Compound Name | tert-butyl N-[3-[(1-methylcyclobutyl)methylcarbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamate |
|---|---|
| PubChem CID | 167111093 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | tert-butyl N-[3-[(1-methylcyclobutyl)methylcarbamoyl]-2-bicyclo[2.2.1]hept-5-enyl]carbamate |
| SMILES | CC1(CNC(=O)C2C3C=CC(C3)C2NC(=O)OC(C)(C)C)CCC1 |
| InChI | InChI=1S/C19H30N2O3/c1-18(2,3)24-17(23)21-15-13-7-6-12(10-13)14(15)16(22)20-11-19(4)8-5-9-19/h6-7,12-15H,5,8-11H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | JCMKMEYXSFEUSW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|