C22H35N7 — CID 170362720
N'-(pyridin-4-ylmethyl)-N-[2-(3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl)ethyl]propane-1,3-diamine (PubChem CID 170362720) has the molecular formula C22H35N7 and a molecular weight of 397.57 g/mol. Its IUPAC name is N'-(pyridin-4-ylmethyl)-N-[2-(3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl)ethyl]propane-1,3-diamine.
| Compound Name | N'-(pyridin-4-ylmethyl)-N-[2-(3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 170362720 |
| Molecular Formula | C22H35N7 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | N'-(pyridin-4-ylmethyl)-N-[2-(3,6,9,15-tetrazabicyclo[9.3.1]pentadeca-1(15),11,13-trien-6-yl)ethyl]propane-1,3-diamine |
| SMILES | c1cc2nc(c1)CNCCN(CCNCCCNCc1ccncc1)CCNC2 |
| InChI | InChI=1S/C22H35N7/c1-3-21-18-26-12-15-29(16-13-27-19-22(4-1)28-21)14-11-23-7-2-8-25-17-20-5-9-24-10-6-20/h1,3-6,9-10,23,25-27H,2,7-8,11-19H2 |
| InChIKey | WGBPRCMZKAUIHZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|