C32H40FIN3O8PS — CID 170366187
(3R,4S)-1-acetyl-N-[3-(1-fluoro-1-iodoethyl)sulfonylphenyl]-4-[[5-(4-formyl-4-methylcyclohexyl)oxy-2-methoxy-4-phosphanylbenzoyl]amino]piperidine-3-carboxamide (PubChem CID 170366187) has the molecular formula C32H40FIN3O8PS and a molecular weight of 803.63 g/mol. Its IUPAC name is (3R,4S)-1-acetyl-N-[3-(1-fluoro-1-iodoethyl)sulfonylphenyl]-4-[[5-(4-formyl-4-methylcyclohexyl)oxy-2-methoxy-4-phosphanylbenzoyl]amino]piperidine-3-carboxamide.
| Compound Name | (3R,4S)-1-acetyl-N-[3-(1-fluoro-1-iodoethyl)sulfonylphenyl]-4-[[5-(4-formyl-4-methylcyclohexyl)oxy-2-methoxy-4-phosphanylbenzoyl]amino]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 170366187 |
| Molecular Formula | C32H40FIN3O8PS |
| Molecular Weight | 803.63 g/mol |
| Exact Mass | 803.13 |
| IUPAC Name | (3R,4S)-1-acetyl-N-[3-(1-fluoro-1-iodoethyl)sulfonylphenyl]-4-[[5-(4-formyl-4-methylcyclohexyl)oxy-2-methoxy-4-phosphanylbenzoyl]amino]piperidine-3-carboxamide |
| SMILES | COc1cc(P)c(OC2CCC(C)(C=O)CC2)cc1C(=O)N[C@H]1CCN(C(C)=O)C[C@H]1C(=O)Nc1cccc(S(=O)(=O)C(C)(F)I)c1 |
| InChI | InChI=1S/C32H40FIN3O8PS/c1-19(39)37-13-10-25(24(17-37)30(41)35-20-6-5-7-22(14-20)47(42,43)32(3,33)34)36-29(40)23-15-27(28(46)16-26(23)44-4)45-21-8-11-31(2,18-38)12-9-21/h5-7,14-16,18,21,24-25H,8-13,17,46H2,1-4H3,(H,35,41)(H,36,40)/t21?,24-,25+,31?,32?/m1/s1 |
| InChIKey | RYXLDAACCOKYFU-ZPHLWYDHSA-N |
| XLogP | 4.18 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.63 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|