C13H12ClN3OS — CID 17036885
1-[(2E)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-4-methyl-1,3-thiazol-3-yl]ethanone (PubChem CID 17036885) has the molecular formula C13H12ClN3OS and a molecular weight of 293.78 g/mol. Its IUPAC name is 1-[(2E)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-4-methyl-1,3-thiazol-3-yl]ethanone.
| Compound Name | 1-[(2E)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-4-methyl-1,3-thiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 17036885 |
| Molecular Formula | C13H12ClN3OS |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 1-[(2E)-2-[(E)-(4-chlorophenyl)methylidenehydrazinylidene]-4-methyl-1,3-thiazol-3-yl]ethanone |
| SMILES | CC(=O)n1c(C)cs/c1=N/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H12ClN3OS/c1-9-8-19-13(17(9)10(2)18)16-15-7-11-3-5-12(14)6-4-11/h3-8H,1-2H3/b15-7+,16-13+ |
| InChIKey | BNKCWSQTIPNUDN-HLVCTGTRSA-N |
| XLogP | 3.11 |
| TPSA | 46.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|