C27H32N6O3S — CID 17037023
N-[4-(4-benzylpiperidine-1-carbonyl)thiadiazol-5-yl]-4-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 17037023) has the molecular formula C27H32N6O3S and a molecular weight of 520.66 g/mol. Its IUPAC name is N-[4-(4-benzylpiperidine-1-carbonyl)thiadiazol-5-yl]-4-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | N-[4-(4-benzylpiperidine-1-carbonyl)thiadiazol-5-yl]-4-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 17037023 |
| Molecular Formula | C27H32N6O3S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | N-[4-(4-benzylpiperidine-1-carbonyl)thiadiazol-5-yl]-4-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)Nc3snnc3C(=O)N3CCC(Cc4ccccc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H32N6O3S/c1-36-23-9-7-22(8-10-23)31-15-17-33(18-16-31)27(35)28-25-24(29-30-37-25)26(34)32-13-11-21(12-14-32)19-20-5-3-2-4-6-20/h2-10,21H,11-19H2,1H3,(H,28,35) |
| InChIKey | PBRFLWZKKOTEEV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|