C25H19F10NO7 — CID 170371359
methyl 8-[bis[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethyl]amino]-8-oxooctanoate (PubChem CID 170371359) has the molecular formula C25H19F10NO7 and a molecular weight of 635.41 g/mol. Its IUPAC name is methyl 8-[bis[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethyl]amino]-8-oxooctanoate.
| Compound Name | methyl 8-[bis[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethyl]amino]-8-oxooctanoate |
|---|---|
| PubChem CID | 170371359 |
| Molecular Formula | C25H19F10NO7 |
| Molecular Weight | 635.41 g/mol |
| Exact Mass | 635.10 |
| IUPAC Name | methyl 8-[bis[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethyl]amino]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)N(CC(=O)Oc1c(F)c(F)c(F)c(F)c1F)CC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H19F10NO7/c1-41-11(38)7-5-3-2-4-6-10(37)36(8-12(39)42-24-20(32)16(28)14(26)17(29)21(24)33)9-13(40)43-25-22(34)18(30)15(27)19(31)23(25)35/h2-9H2,1H3 |
| InChIKey | CKBBRLQLAYNZGE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|