C24H37NO2 — CID 170371825
(2R)-1-[3-(3-tert-butylphenyl)-8-azaspiro[4.5]decan-8-yl]-2-(hydroxymethyl)butan-1-one (PubChem CID 170371825) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is (2R)-1-[3-(3-tert-butylphenyl)-8-azaspiro[4.5]decan-8-yl]-2-(hydroxymethyl)butan-1-one.
| Compound Name | (2R)-1-[3-(3-tert-butylphenyl)-8-azaspiro[4.5]decan-8-yl]-2-(hydroxymethyl)butan-1-one |
|---|---|
| PubChem CID | 170371825 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | (2R)-1-[3-(3-tert-butylphenyl)-8-azaspiro[4.5]decan-8-yl]-2-(hydroxymethyl)butan-1-one |
| SMILES | CC[C@H](CO)C(=O)N1CCC2(CCC(c3cccc(C(C)(C)C)c3)C2)CC1 |
| InChI | InChI=1S/C24H37NO2/c1-5-18(17-26)22(27)25-13-11-24(12-14-25)10-9-20(16-24)19-7-6-8-21(15-19)23(2,3)4/h6-8,15,18,20,26H,5,9-14,16-17H2,1-4H3/t18-,20?/m1/s1 |
| InChIKey | AOBNTTWJEUFJGR-QSVWIEALSA-N |
| XLogP | 4.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |