C21H42N2O — CID 170372476
(2S)-2-methyl-4-propan-2-yl-1-[4-(4-propan-2-yloxycyclohexyl)butyl]piperazine (PubChem CID 170372476) has the molecular formula C21H42N2O and a molecular weight of 338.58 g/mol. Its IUPAC name is (2S)-2-methyl-4-propan-2-yl-1-[4-(4-propan-2-yloxycyclohexyl)butyl]piperazine.
| Compound Name | (2S)-2-methyl-4-propan-2-yl-1-[4-(4-propan-2-yloxycyclohexyl)butyl]piperazine |
|---|---|
| PubChem CID | 170372476 |
| Molecular Formula | C21H42N2O |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.33 |
| IUPAC Name | (2S)-2-methyl-4-propan-2-yl-1-[4-(4-propan-2-yloxycyclohexyl)butyl]piperazine |
| SMILES | CC(C)OC1CCC(CCCCN2CCN(C(C)C)C[C@@H]2C)CC1 |
| InChI | InChI=1S/C21H42N2O/c1-17(2)23-15-14-22(19(5)16-23)13-7-6-8-20-9-11-21(12-10-20)24-18(3)4/h17-21H,6-16H2,1-5H3/t19-,20?,21?/m0/s1 |
| InChIKey | YBESGHJUGLYLBZ-MWXLCCTBSA-N |
| XLogP | 4.55 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|