C23H48N2 — CID 170569249
(2S)-1-(4-cyclohexylbutyl)-2,6-dimethyl-4-propan-2-ylpiperazine;2-methylpropane (PubChem CID 170569249) has the molecular formula C23H48N2 and a molecular weight of 352.65 g/mol. Its IUPAC name is (2S)-1-(4-cyclohexylbutyl)-2,6-dimethyl-4-propan-2-ylpiperazine;2-methylpropane.
| Compound Name | (2S)-1-(4-cyclohexylbutyl)-2,6-dimethyl-4-propan-2-ylpiperazine;2-methylpropane |
|---|---|
| PubChem CID | 170569249 |
| Molecular Formula | C23H48N2 |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 352.38 |
| IUPAC Name | (2S)-1-(4-cyclohexylbutyl)-2,6-dimethyl-4-propan-2-ylpiperazine;2-methylpropane |
| SMILES | CC(C)C.CC(C)N1CC(C)N(CCCCC2CCCCC2)[C@@H](C)C1 |
| InChI | InChI=1S/C19H38N2.C4H10/c1-16(2)20-14-17(3)21(18(4)15-20)13-9-8-12-19-10-6-5-7-11-19;1-4(2)3/h16-19H,5-15H2,1-4H3;4H,1-3H3/t17-,18?;/m0./s1 |
| InChIKey | JLJNYIXCQYITKR-OQICONIUSA-N |
| XLogP | 6.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|