C21H39F3N2O — CID 170372801
(2S)-1-propan-2-yl-4-[4-(4-propan-2-yloxycyclohexyl)butyl]-2-(trifluoromethyl)piperazine (PubChem CID 170372801) has the molecular formula C21H39F3N2O and a molecular weight of 392.55 g/mol. Its IUPAC name is (2S)-1-propan-2-yl-4-[4-(4-propan-2-yloxycyclohexyl)butyl]-2-(trifluoromethyl)piperazine.
| Compound Name | (2S)-1-propan-2-yl-4-[4-(4-propan-2-yloxycyclohexyl)butyl]-2-(trifluoromethyl)piperazine |
|---|---|
| PubChem CID | 170372801 |
| Molecular Formula | C21H39F3N2O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | (2S)-1-propan-2-yl-4-[4-(4-propan-2-yloxycyclohexyl)butyl]-2-(trifluoromethyl)piperazine |
| SMILES | CC(C)OC1CCC(CCCCN2CCN(C(C)C)[C@H](C(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C21H39F3N2O/c1-16(2)26-14-13-25(15-20(26)21(22,23)24)12-6-5-7-18-8-10-19(11-9-18)27-17(3)4/h16-20H,5-15H2,1-4H3/t18?,19?,20-/m0/s1 |
| InChIKey | LDKOATKZBZGIGJ-MHJFOBGBSA-N |
| XLogP | 5.10 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|