C24H48N2O — CID 175628931
(2R)-1-butan-2-yl-2-methyl-4-[4-(4-pentan-2-yloxycyclohexyl)butyl]piperazine (PubChem CID 175628931) has the molecular formula C24H48N2O and a molecular weight of 380.66 g/mol. Its IUPAC name is (2R)-1-butan-2-yl-2-methyl-4-[4-(4-pentan-2-yloxycyclohexyl)butyl]piperazine.
| Compound Name | (2R)-1-butan-2-yl-2-methyl-4-[4-(4-pentan-2-yloxycyclohexyl)butyl]piperazine |
|---|---|
| PubChem CID | 175628931 |
| Molecular Formula | C24H48N2O |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.38 |
| IUPAC Name | (2R)-1-butan-2-yl-2-methyl-4-[4-(4-pentan-2-yloxycyclohexyl)butyl]piperazine |
| SMILES | CCCC(C)OC1CCC(CCCCN2CCN(C(C)CC)[C@H](C)C2)CC1 |
| InChI | InChI=1S/C24H48N2O/c1-6-10-22(5)27-24-14-12-23(13-15-24)11-8-9-16-25-17-18-26(20(3)7-2)21(4)19-25/h20-24H,6-19H2,1-5H3/t20?,21-,22?,23?,24?/m1/s1 |
| InChIKey | HITZOMZVLCGKKK-OVHOTPAZSA-N |
| XLogP | 5.73 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|