C19H32N4O4S2 — CID 170374194
1-[2-(butan-2-yloxymethoxy)ethyl]-3-[4-[2-(methoxymethoxy)ethylcarbamothioylamino]phenyl]thiourea (PubChem CID 170374194) has the molecular formula C19H32N4O4S2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 1-[2-(butan-2-yloxymethoxy)ethyl]-3-[4-[2-(methoxymethoxy)ethylcarbamothioylamino]phenyl]thiourea.
| Compound Name | 1-[2-(butan-2-yloxymethoxy)ethyl]-3-[4-[2-(methoxymethoxy)ethylcarbamothioylamino]phenyl]thiourea |
|---|---|
| PubChem CID | 170374194 |
| Molecular Formula | C19H32N4O4S2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 1-[2-(butan-2-yloxymethoxy)ethyl]-3-[4-[2-(methoxymethoxy)ethylcarbamothioylamino]phenyl]thiourea |
| SMILES | CCC(C)OCOCCNC(=S)Nc1ccc(NC(=S)NCCOCOC)cc1 |
| InChI | InChI=1S/C19H32N4O4S2/c1-4-15(2)27-14-26-12-10-21-19(29)23-17-7-5-16(6-8-17)22-18(28)20-9-11-25-13-24-3/h5-8,15H,4,9-14H2,1-3H3,(H2,20,22,28)(H2,21,23,29) |
| InChIKey | AZDOCHSMDQMLIL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|