C16H23N3O3 — CID 170376753
[3-(2-aminoethyl)-1H-pyrrolo[2,3-c]pyridin-4-yl] hexyl carbonate (PubChem CID 170376753) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is [3-(2-aminoethyl)-1H-pyrrolo[2,3-c]pyridin-4-yl] hexyl carbonate.
| Compound Name | [3-(2-aminoethyl)-1H-pyrrolo[2,3-c]pyridin-4-yl] hexyl carbonate |
|---|---|
| PubChem CID | 170376753 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | [3-(2-aminoethyl)-1H-pyrrolo[2,3-c]pyridin-4-yl] hexyl carbonate |
| SMILES | CCCCCCOC(=O)Oc1cncc2[nH]cc(CCN)c12 |
| InChI | InChI=1S/C16H23N3O3/c1-2-3-4-5-8-21-16(20)22-14-11-18-10-13-15(14)12(6-7-17)9-19-13/h9-11,19H,2-8,17H2,1H3 |
| InChIKey | ATQQIEPWJKIHFW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|