C30H31ClN6O7 — CID 170382208
ethyl 2-[[2-[3-[(4-amino-3-chlorobenzoyl)amino]-2-oxo-1-pyridinyl]propanoylamino]-[(E)-4-(benzylamino)-4-oxobut-2-enoyl]amino]acetate (PubChem CID 170382208) has the molecular formula C30H31ClN6O7 and a molecular weight of 623.07 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[(4-amino-3-chlorobenzoyl)amino]-2-oxo-1-pyridinyl]propanoylamino]-[(E)-4-(benzylamino)-4-oxobut-2-enoyl]amino]acetate.
| Compound Name | ethyl 2-[[2-[3-[(4-amino-3-chlorobenzoyl)amino]-2-oxo-1-pyridinyl]propanoylamino]-[(E)-4-(benzylamino)-4-oxobut-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 170382208 |
| Molecular Formula | C30H31ClN6O7 |
| Molecular Weight | 623.07 g/mol |
| Exact Mass | 622.19 |
| IUPAC Name | ethyl 2-[[2-[3-[(4-amino-3-chlorobenzoyl)amino]-2-oxo-1-pyridinyl]propanoylamino]-[(E)-4-(benzylamino)-4-oxobut-2-enoyl]amino]acetate |
| SMILES | CCOC(=O)CN(NC(=O)C(C)n1cccc(NC(=O)c2ccc(N)c(Cl)c2)c1=O)C(=O)/C=C/C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C30H31ClN6O7/c1-3-44-27(40)18-37(26(39)14-13-25(38)33-17-20-8-5-4-6-9-20)35-28(41)19(2)36-15-7-10-24(30(36)43)34-29(42)21-11-12-23(32)22(31)16-21/h4-16,19H,3,17-18,32H2,1-2H3,(H,33,38)(H,34,42)(H,35,41)/b14-13+ |
| InChIKey | KLIJHVFZPHJADO-BUHFOSPRSA-N |
| XLogP | 2.19 |
| TPSA | 181.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.07 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|