C28H32ClN5O8 — CID 170314712
2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[(E)-4-methoxy-4-oxobut-2-enoyl]amino]acetic acid (PubChem CID 170314712) has the molecular formula C28H32ClN5O8 and a molecular weight of 602.04 g/mol. Its IUPAC name is 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[(E)-4-methoxy-4-oxobut-2-enoyl]amino]acetic acid.
| Compound Name | 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[(E)-4-methoxy-4-oxobut-2-enoyl]amino]acetic acid |
|---|---|
| PubChem CID | 170314712 |
| Molecular Formula | C28H32ClN5O8 |
| Molecular Weight | 602.04 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[(E)-4-methoxy-4-oxobut-2-enoyl]amino]acetic acid |
| SMILES | COC(=O)/C=C/C(=O)N(CC(=O)O)NC(=O)C(NC(=O)[C@@H](NC(=O)c1ccc(N)c(Cl)c1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C28H32ClN5O8/c1-28(2,3)24(32-25(39)17-10-11-19(30)18(29)14-17)27(41)31-23(16-8-6-5-7-9-16)26(40)33-34(15-21(36)37)20(35)12-13-22(38)42-4/h5-14,23-24H,15,30H2,1-4H3,(H,31,41)(H,32,39)(H,33,40)(H,36,37)/b13-12+/t23?,24-/m1/s1 |
| InChIKey | YNEWOHSOLKKLPN-NZZDUDRTSA-N |
| XLogP | 1.60 |
| TPSA | 197.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.04 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|