C30H37ClFN5O6 — CID 170570717
tert-butyl 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-(2-fluoroprop-2-enoyl)amino]acetate (PubChem CID 170570717) has the molecular formula C30H37ClFN5O6 and a molecular weight of 618.11 g/mol. Its IUPAC name is tert-butyl 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-(2-fluoroprop-2-enoyl)amino]acetate.
| Compound Name | tert-butyl 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-(2-fluoroprop-2-enoyl)amino]acetate |
|---|---|
| PubChem CID | 170570717 |
| Molecular Formula | C30H37ClFN5O6 |
| Molecular Weight | 618.11 g/mol |
| Exact Mass | 617.24 |
| IUPAC Name | tert-butyl 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-(2-fluoroprop-2-enoyl)amino]acetate |
| SMILES | C=C(F)C(=O)N(CC(=O)OC(C)(C)C)NC(=O)C(NC(=O)[C@@H](NC(=O)c1ccc(N)c(Cl)c1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H37ClFN5O6/c1-17(32)28(42)37(16-22(38)43-30(5,6)7)36-26(40)23(18-11-9-8-10-12-18)34-27(41)24(29(2,3)4)35-25(39)19-13-14-21(33)20(31)15-19/h8-15,23-24H,1,16,33H2,2-7H3,(H,34,41)(H,35,39)(H,36,40)/t23?,24-/m1/s1 |
| InChIKey | YWZKUURTLPNBEN-XMMISQBUSA-N |
| XLogP | 3.61 |
| TPSA | 159.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.11 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|