C29H33ClF3N5O6 — CID 170314791
ethyl 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-[3-(trifluoromethyl)phenyl]acetyl]amino]-prop-2-enoylamino]acetate (PubChem CID 170314791) has the molecular formula C29H33ClF3N5O6 and a molecular weight of 640.06 g/mol. Its IUPAC name is ethyl 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-[3-(trifluoromethyl)phenyl]acetyl]amino]-prop-2-enoylamino]acetate.
| Compound Name | ethyl 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-[3-(trifluoromethyl)phenyl]acetyl]amino]-prop-2-enoylamino]acetate |
|---|---|
| PubChem CID | 170314791 |
| Molecular Formula | C29H33ClF3N5O6 |
| Molecular Weight | 640.06 g/mol |
| Exact Mass | 639.21 |
| IUPAC Name | ethyl 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-[3-(trifluoromethyl)phenyl]acetyl]amino]-prop-2-enoylamino]acetate |
| SMILES | C=CC(=O)N(CC(=O)OCC)NC(=O)C(NC(=O)[C@@H](NC(=O)c1ccc(N)c(Cl)c1)C(C)(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H33ClF3N5O6/c1-6-21(39)38(15-22(40)44-7-2)37-26(42)23(16-9-8-10-18(13-16)29(31,32)33)35-27(43)24(28(3,4)5)36-25(41)17-11-12-20(34)19(30)14-17/h6,8-14,23-24H,1,7,15,34H2,2-5H3,(H,35,43)(H,36,41)(H,37,42)/t23?,24-/m1/s1 |
| InChIKey | XGZULHILHVIUET-XMMISQBUSA-N |
| XLogP | 3.55 |
| TPSA | 159.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.06 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|