C23H25ClF3N3O4 — CID 170314990
methyl 2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 170314990) has the molecular formula C23H25ClF3N3O4 and a molecular weight of 499.92 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | methyl 2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 170314990 |
| Molecular Formula | C23H25ClF3N3O4 |
| Molecular Weight | 499.92 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | methyl 2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | COC(=O)C(NC(=O)[C@@H](NC(=O)c1ccc(N)c(Cl)c1)C(C)(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H25ClF3N3O4/c1-22(2,3)18(30-19(31)13-8-9-16(28)15(24)11-13)20(32)29-17(21(33)34-4)12-6-5-7-14(10-12)23(25,26)27/h5-11,17-18H,28H2,1-4H3,(H,29,32)(H,30,31)/t17?,18-/m1/s1 |
| InChIKey | NHKYGMZVHCCSSN-QRWMCTBCSA-N |
| XLogP | 4.12 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.92 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|