C27H31ClF3N5O5 — CID 170570555
4-amino-3-chloro-N-[(2S)-3,3-dimethyl-1-oxo-1-[[(1S)-2-oxo-1-phenyl-2-[2-prop-2-enoyl-2-(3,3,3-trifluoro-2-hydroxypropyl)hydrazinyl]ethyl]amino]butan-2-yl]benzamide (PubChem CID 170570555) has the molecular formula C27H31ClF3N5O5 and a molecular weight of 598.02 g/mol. Its IUPAC name is 4-amino-3-chloro-N-[(2S)-3,3-dimethyl-1-oxo-1-[[(1S)-2-oxo-1-phenyl-2-[2-prop-2-enoyl-2-(3,3,3-trifluoro-2-hydroxypropyl)hydrazinyl]ethyl]amino]butan-2-yl]benzamide.
| Compound Name | 4-amino-3-chloro-N-[(2S)-3,3-dimethyl-1-oxo-1-[[(1S)-2-oxo-1-phenyl-2-[2-prop-2-enoyl-2-(3,3,3-trifluoro-2-hydroxypropyl)hydrazinyl]ethyl]amino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 170570555 |
| Molecular Formula | C27H31ClF3N5O5 |
| Molecular Weight | 598.02 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 4-amino-3-chloro-N-[(2S)-3,3-dimethyl-1-oxo-1-[[(1S)-2-oxo-1-phenyl-2-[2-prop-2-enoyl-2-(3,3,3-trifluoro-2-hydroxypropyl)hydrazinyl]ethyl]amino]butan-2-yl]benzamide |
| SMILES | C=CC(=O)N(CC(O)C(F)(F)F)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1ccc(N)c(Cl)c1)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C27H31ClF3N5O5/c1-5-20(38)36(14-19(37)27(29,30)31)35-24(40)21(15-9-7-6-8-10-15)33-25(41)22(26(2,3)4)34-23(39)16-11-12-18(32)17(28)13-16/h5-13,19,21-22,37H,1,14,32H2,2-4H3,(H,33,41)(H,34,39)(H,35,40)/t19?,21-,22+/m0/s1 |
| InChIKey | IYXBQSUKSWTUAJ-YPURBLFUSA-N |
| XLogP | 2.89 |
| TPSA | 153.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.02 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|