C25H29Cl2N5O6 — CID 170315028
2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-(2-chloroacetyl)amino]acetic acid (PubChem CID 170315028) has the molecular formula C25H29Cl2N5O6 and a molecular weight of 566.44 g/mol. Its IUPAC name is 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-(2-chloroacetyl)amino]acetic acid.
| Compound Name | 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-(2-chloroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 170315028 |
| Molecular Formula | C25H29Cl2N5O6 |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | 2-[[[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-(2-chloroacetyl)amino]acetic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)c1ccc(N)c(Cl)c1)C(=O)NC(C(=O)NN(CC(=O)O)C(=O)CCl)c1ccccc1 |
| InChI | InChI=1S/C25H29Cl2N5O6/c1-25(2,3)21(30-22(36)15-9-10-17(28)16(27)11-15)24(38)29-20(14-7-5-4-6-8-14)23(37)31-32(13-19(34)35)18(33)12-26/h4-11,20-21H,12-13,28H2,1-3H3,(H,29,38)(H,30,36)(H,31,37)(H,34,35)/t20?,21-/m1/s1 |
| InChIKey | MIOXIFISLHYDLK-BPGUCPLFSA-N |
| XLogP | 2.11 |
| TPSA | 170.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|