C22H32ClN5O5 — CID 170570549
ethyl 2-[2-[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-cyclopropylacetyl]hydrazinyl]acetate (PubChem CID 170570549) has the molecular formula C22H32ClN5O5 and a molecular weight of 481.98 g/mol. Its IUPAC name is ethyl 2-[2-[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-cyclopropylacetyl]hydrazinyl]acetate.
| Compound Name | ethyl 2-[2-[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-cyclopropylacetyl]hydrazinyl]acetate |
|---|---|
| PubChem CID | 170570549 |
| Molecular Formula | C22H32ClN5O5 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | ethyl 2-[2-[2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-cyclopropylacetyl]hydrazinyl]acetate |
| SMILES | CCOC(=O)CNNC(=O)C(NC(=O)[C@@H](NC(=O)c1ccc(N)c(Cl)c1)C(C)(C)C)C1CC1 |
| InChI | InChI=1S/C22H32ClN5O5/c1-5-33-16(29)11-25-28-20(31)17(12-6-7-12)26-21(32)18(22(2,3)4)27-19(30)13-8-9-15(24)14(23)10-13/h8-10,12,17-18,25H,5-7,11,24H2,1-4H3,(H,26,32)(H,27,30)(H,28,31)/t17?,18-/m1/s1 |
| InChIKey | RGQBVTORBWPVSK-QRWMCTBCSA-N |
| XLogP | 1.15 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|