C36H41ClN6O7 — CID 170570747
ethyl 2-[[[(2S)-2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[(E)-4-(benzylamino)-4-oxobut-2-enoyl]amino]acetate (PubChem CID 170570747) has the molecular formula C36H41ClN6O7 and a molecular weight of 705.21 g/mol. Its IUPAC name is ethyl 2-[[[(2S)-2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[(E)-4-(benzylamino)-4-oxobut-2-enoyl]amino]acetate.
| Compound Name | ethyl 2-[[[(2S)-2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[(E)-4-(benzylamino)-4-oxobut-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 170570747 |
| Molecular Formula | C36H41ClN6O7 |
| Molecular Weight | 705.21 g/mol |
| Exact Mass | 704.27 |
| IUPAC Name | ethyl 2-[[[(2S)-2-[[(2S)-2-[(4-amino-3-chlorobenzoyl)amino]-3,3-dimethylbutanoyl]amino]-2-phenylacetyl]amino]-[(E)-4-(benzylamino)-4-oxobut-2-enoyl]amino]acetate |
| SMILES | CCOC(=O)CN(NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1ccc(N)c(Cl)c1)C(C)(C)C)c1ccccc1)C(=O)/C=C/C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C36H41ClN6O7/c1-5-50-30(46)22-43(29(45)19-18-28(44)39-21-23-12-8-6-9-13-23)42-34(48)31(24-14-10-7-11-15-24)40-35(49)32(36(2,3)4)41-33(47)25-16-17-27(38)26(37)20-25/h6-20,31-32H,5,21-22,38H2,1-4H3,(H,39,44)(H,40,49)(H,41,47)(H,42,48)/b19-18+/t31-,32+/m0/s1 |
| InChIKey | LRYUKGFHJRTJKH-ARYHZBOQSA-N |
| XLogP | 3.22 |
| TPSA | 189.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|