C25H26F4IN5O6S4 — CID 170386231
2-(2-fluoro-4-iodoanilino)-1,5-dimethyl-6-oxo-N-propan-2-yl-4-[2-(trifluoromethoxy)-3-[tris(sulfanyl)methylsulfamoylamino]phenoxy]pyridine-3-carboxamide (PubChem CID 170386231) has the molecular formula C25H26F4IN5O6S4 and a molecular weight of 823.68 g/mol. Its IUPAC name is 2-(2-fluoro-4-iodoanilino)-1,5-dimethyl-6-oxo-N-propan-2-yl-4-[2-(trifluoromethoxy)-3-[tris(sulfanyl)methylsulfamoylamino]phenoxy]pyridine-3-carboxamide.
| Compound Name | 2-(2-fluoro-4-iodoanilino)-1,5-dimethyl-6-oxo-N-propan-2-yl-4-[2-(trifluoromethoxy)-3-[tris(sulfanyl)methylsulfamoylamino]phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170386231 |
| Molecular Formula | C25H26F4IN5O6S4 |
| Molecular Weight | 823.68 g/mol |
| Exact Mass | 822.97 |
| IUPAC Name | 2-(2-fluoro-4-iodoanilino)-1,5-dimethyl-6-oxo-N-propan-2-yl-4-[2-(trifluoromethoxy)-3-[tris(sulfanyl)methylsulfamoylamino]phenoxy]pyridine-3-carboxamide |
| SMILES | Cc1c(Oc2cccc(NS(=O)(=O)NC(S)(S)S)c2OC(F)(F)F)c(C(=O)NC(C)C)c(Nc2ccc(I)cc2F)n(C)c1=O |
| InChI | InChI=1S/C25H26F4IN5O6S4/c1-11(2)31-22(36)18-19(12(3)23(37)35(4)21(18)32-15-9-8-13(30)10-14(15)26)40-17-7-5-6-16(20(17)41-24(27,28)29)33-45(38,39)34-25(42,43)44/h5-11,32-34,42-44H,1-4H3,(H,31,36) |
| InChIKey | JRRFGIWMSOPWLP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|