C26H38N6O — CID 170390308
4-N-[4-[4-amino-3-(N-methyl-C-propan-2-ylcarbonimidoyl)phenyl]pyrimidin-2-yl]-1-N-(oxan-4-yl)cyclohexane-1,4-diamine (PubChem CID 170390308) has the molecular formula C26H38N6O and a molecular weight of 450.63 g/mol. Its IUPAC name is 4-N-[4-[4-amino-3-(N-methyl-C-propan-2-ylcarbonimidoyl)phenyl]pyrimidin-2-yl]-1-N-(oxan-4-yl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-[4-[4-amino-3-(N-methyl-C-propan-2-ylcarbonimidoyl)phenyl]pyrimidin-2-yl]-1-N-(oxan-4-yl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 170390308 |
| Molecular Formula | C26H38N6O |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 4-N-[4-[4-amino-3-(N-methyl-C-propan-2-ylcarbonimidoyl)phenyl]pyrimidin-2-yl]-1-N-(oxan-4-yl)cyclohexane-1,4-diamine |
| SMILES | C/N=C(/c1cc(-c2ccnc(NC3CCC(NC4CCOCC4)CC3)n2)ccc1N)C(C)C |
| InChI | InChI=1S/C26H38N6O/c1-17(2)25(28-3)22-16-18(4-9-23(22)27)24-10-13-29-26(32-24)31-20-7-5-19(6-8-20)30-21-11-14-33-15-12-21/h4,9-10,13,16-17,19-21,30H,5-8,11-12,14-15,27H2,1-3H3,(H,29,31,32)/b28-25+ |
| InChIKey | KTDIOEQYFUCEOJ-AZPGRJICSA-N |
| XLogP | 4.29 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|