C27H37N6 — CID 170568639
CID 170568639 (PubChem CID 170568639) has the molecular formula C27H37N6 and a molecular weight of 445.64 g/mol.
| Compound Name | CID 170568639 |
|---|---|
| PubChem CID | 170568639 |
| Molecular Formula | C27H37N6 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | — |
| SMILES | C/N=C(/c1cc(-c2ccnc(NC3CCC(NCCCC4=C[CH]4)CC3)n2)ccc1N)C(C)C |
| InChI | InChI=1S/C27H37N6/c1-18(2)26(29-3)23-17-20(8-13-24(23)28)25-14-16-31-27(33-25)32-22-11-9-21(10-12-22)30-15-4-5-19-6-7-19/h6-8,13-14,16-18,21-22,30H,4-5,9-12,15,28H2,1-3H3,(H,31,32,33)/b29-26+ |
| InChIKey | NBXYTDNQYMDRNZ-PBBVDAKRSA-N |
| XLogP | 5.04 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|