C12H17NO2 — CID 170396660
tert-butyl (3R,5S)-3-ethynyl-2-azabicyclo[3.1.0]hexane-2-carboxylate (PubChem CID 170396660) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3-ethynyl-2-azabicyclo[3.1.0]hexane-2-carboxylate.
| Compound Name | tert-butyl (3R,5S)-3-ethynyl-2-azabicyclo[3.1.0]hexane-2-carboxylate |
|---|---|
| PubChem CID | 170396660 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | tert-butyl (3R,5S)-3-ethynyl-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| SMILES | C#C[C@H]1C[C@@H]2CC2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H17NO2/c1-5-9-6-8-7-10(8)13(9)11(14)15-12(2,3)4/h1,8-10H,6-7H2,2-4H3/t8-,9+,10?/m1/s1 |
| InChIKey | KELHMRPQBXHCSU-ZDGBYWQASA-N |
| XLogP | 2.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|