C12H20N2O2 — CID 138461253
tert-butyl (2S,6R)-2-ethynyl-6-methylpiperazine-1-carboxylate (PubChem CID 138461253) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is tert-butyl (2S,6R)-2-ethynyl-6-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2S,6R)-2-ethynyl-6-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 138461253 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | tert-butyl (2S,6R)-2-ethynyl-6-methylpiperazine-1-carboxylate |
| SMILES | C#C[C@H]1CNC[C@@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H20N2O2/c1-6-10-8-13-7-9(2)14(10)11(15)16-12(3,4)5/h1,9-10,13H,7-8H2,2-5H3/t9-,10+/m1/s1 |
| InChIKey | GWORZUZKDUIEOD-ZJUUUORDSA-N |
| XLogP | 1.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|