C11H19N2O3+ — CID 59982279
tert-butyl (4S)-4-ethynyl-2,2-dimethyloxadiazolidin-2-ium-3-carboxylate (PubChem CID 59982279) has the molecular formula C11H19N2O3+ and a molecular weight of 227.28 g/mol. Its IUPAC name is tert-butyl (4S)-4-ethynyl-2,2-dimethyloxadiazolidin-2-ium-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-ethynyl-2,2-dimethyloxadiazolidin-2-ium-3-carboxylate |
|---|---|
| PubChem CID | 59982279 |
| Molecular Formula | C11H19N2O3+ |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | tert-butyl (4S)-4-ethynyl-2,2-dimethyloxadiazolidin-2-ium-3-carboxylate |
| SMILES | C#C[C@H]1CO[N+](C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19N2O3/c1-7-9-8-15-13(5,6)12(9)10(14)16-11(2,3)4/h1,9H,8H2,2-6H3/q+1/t9-/m0/s1 |
| InChIKey | YBQAVHVJIBEXPN-VIFPVBQESA-N |
| XLogP | 1.16 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|