C13H16N2 — CID 17039687
3,8-diethylquinolin-2-amine (PubChem CID 17039687) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3,8-diethylquinolin-2-amine.
| Compound Name | 3,8-diethylquinolin-2-amine |
|---|---|
| PubChem CID | 17039687 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3,8-diethylquinolin-2-amine |
| SMILES | CCc1cc2cccc(CC)c2nc1N |
| InChI | InChI=1S/C13H16N2/c1-3-9-6-5-7-11-8-10(4-2)13(14)15-12(9)11/h5-8H,3-4H2,1-2H3,(H2,14,15) |
| InChIKey | WKCOWLLZBGOAKT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |