C30H33N5O3S — CID 170397168
3-amino-N-[4-(2-piperidin-3-ylphenoxy)-6-(2-propan-2-ylphenyl)pyrimidin-2-yl]benzenesulfonamide (PubChem CID 170397168) has the molecular formula C30H33N5O3S and a molecular weight of 543.69 g/mol. Its IUPAC name is 3-amino-N-[4-(2-piperidin-3-ylphenoxy)-6-(2-propan-2-ylphenyl)pyrimidin-2-yl]benzenesulfonamide.
| Compound Name | 3-amino-N-[4-(2-piperidin-3-ylphenoxy)-6-(2-propan-2-ylphenyl)pyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 170397168 |
| Molecular Formula | C30H33N5O3S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 3-amino-N-[4-(2-piperidin-3-ylphenoxy)-6-(2-propan-2-ylphenyl)pyrimidin-2-yl]benzenesulfonamide |
| SMILES | CC(C)c1ccccc1-c1cc(Oc2ccccc2C2CCCNC2)nc(NS(=O)(=O)c2cccc(N)c2)n1 |
| InChI | InChI=1S/C30H33N5O3S/c1-20(2)24-12-3-4-14-26(24)27-18-29(38-28-15-6-5-13-25(28)21-9-8-16-32-19-21)34-30(33-27)35-39(36,37)23-11-7-10-22(31)17-23/h3-7,10-15,17-18,20-21,32H,8-9,16,19,31H2,1-2H3,(H,33,34,35) |
| InChIKey | QAYYMLVVRSCIHU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|