C30H33ClN6OS — CID 167004955
N-(3-aminophenyl)sulfanyl-4-[2-chloro-5-(4-methylpiperazin-1-yl)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-amine (PubChem CID 167004955) has the molecular formula C30H33ClN6OS and a molecular weight of 561.16 g/mol. Its IUPAC name is N-(3-aminophenyl)sulfanyl-4-[2-chloro-5-(4-methylpiperazin-1-yl)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-amine.
| Compound Name | N-(3-aminophenyl)sulfanyl-4-[2-chloro-5-(4-methylpiperazin-1-yl)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 167004955 |
| Molecular Formula | C30H33ClN6OS |
| Molecular Weight | 561.16 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | N-(3-aminophenyl)sulfanyl-4-[2-chloro-5-(4-methylpiperazin-1-yl)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-amine |
| SMILES | CC(C)c1ccccc1-c1cc(Oc2cc(N3CCN(C)CC3)ccc2Cl)nc(NSc2cccc(N)c2)n1 |
| InChI | InChI=1S/C30H33ClN6OS/c1-20(2)24-9-4-5-10-25(24)27-19-29(34-30(33-27)35-39-23-8-6-7-21(32)17-23)38-28-18-22(11-12-26(28)31)37-15-13-36(3)14-16-37/h4-12,17-20H,13-16,32H2,1-3H3,(H,33,34,35) |
| InChIKey | MPMBROCYEQPCFU-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.16 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|