C30H37N7OS — CID 163248035
4-[2,6-di(propan-2-yl)phenyl]-N-(1-methylpyrazol-4-yl)sulfanyl-6-(4-piperazin-1-ylphenoxy)pyrimidin-2-amine (PubChem CID 163248035) has the molecular formula C30H37N7OS and a molecular weight of 543.74 g/mol. Its IUPAC name is 4-[2,6-di(propan-2-yl)phenyl]-N-(1-methylpyrazol-4-yl)sulfanyl-6-(4-piperazin-1-ylphenoxy)pyrimidin-2-amine.
| Compound Name | 4-[2,6-di(propan-2-yl)phenyl]-N-(1-methylpyrazol-4-yl)sulfanyl-6-(4-piperazin-1-ylphenoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 163248035 |
| Molecular Formula | C30H37N7OS |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 4-[2,6-di(propan-2-yl)phenyl]-N-(1-methylpyrazol-4-yl)sulfanyl-6-(4-piperazin-1-ylphenoxy)pyrimidin-2-amine |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1cc(Oc2ccc(N3CCNCC3)cc2)nc(NSc2cnn(C)c2)n1 |
| InChI | InChI=1S/C30H37N7OS/c1-20(2)25-7-6-8-26(21(3)4)29(25)27-17-28(34-30(33-27)35-39-24-18-32-36(5)19-24)38-23-11-9-22(10-12-23)37-15-13-31-14-16-37/h6-12,17-21,31H,13-16H2,1-5H3,(H,33,34,35) |
| InChIKey | DWJTUCSETUIIST-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|