C27H30N6O2S — CID 163248013
4-(2,6-dimethylphenyl)-6-[4-(4-methylmorpholin-2-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine (PubChem CID 163248013) has the molecular formula C27H30N6O2S and a molecular weight of 502.64 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)-6-[4-(4-methylmorpholin-2-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine.
| Compound Name | 4-(2,6-dimethylphenyl)-6-[4-(4-methylmorpholin-2-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 163248013 |
| Molecular Formula | C27H30N6O2S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 4-(2,6-dimethylphenyl)-6-[4-(4-methylmorpholin-2-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine |
| SMILES | Cc1cccc(C)c1-c1cc(Oc2ccc(C3CN(C)CCO3)cc2)nc(NSc2cnn(C)c2)n1 |
| InChI | InChI=1S/C27H30N6O2S/c1-18-6-5-7-19(2)26(18)23-14-25(30-27(29-23)31-36-22-15-28-33(4)16-22)35-21-10-8-20(9-11-21)24-17-32(3)12-13-34-24/h5-11,14-16,24H,12-13,17H2,1-4H3,(H,29,30,31) |
| InChIKey | MAGVAQWEGBGRBN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|