C16H16ClN5S — CID 163247925
4-chloro-6-(2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine (PubChem CID 163247925) has the molecular formula C16H16ClN5S and a molecular weight of 345.86 g/mol. Its IUPAC name is 4-chloro-6-(2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine.
| Compound Name | 4-chloro-6-(2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 163247925 |
| Molecular Formula | C16H16ClN5S |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-chloro-6-(2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine |
| SMILES | Cc1cccc(C)c1-c1cc(Cl)nc(NSc2cnn(C)c2)n1 |
| InChI | InChI=1S/C16H16ClN5S/c1-10-5-4-6-11(2)15(10)13-7-14(17)20-16(19-13)21-23-12-8-18-22(3)9-12/h4-9H,1-3H3,(H,19,20,21) |
| InChIKey | KAAQLTKWXJUZNT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|