C10H8Cl2F3N5S — CID 163247078
4,6-dichloro-N-(1-methylpyrazol-4-yl)sulfanyl-5-(2,2,2-trifluoroethyl)pyrimidin-2-amine (PubChem CID 163247078) has the molecular formula C10H8Cl2F3N5S and a molecular weight of 358.18 g/mol. Its IUPAC name is 4,6-dichloro-N-(1-methylpyrazol-4-yl)sulfanyl-5-(2,2,2-trifluoroethyl)pyrimidin-2-amine.
| Compound Name | 4,6-dichloro-N-(1-methylpyrazol-4-yl)sulfanyl-5-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 163247078 |
| Molecular Formula | C10H8Cl2F3N5S |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 4,6-dichloro-N-(1-methylpyrazol-4-yl)sulfanyl-5-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
| SMILES | Cn1cc(SNc2nc(Cl)c(CC(F)(F)F)c(Cl)n2)cn1 |
| InChI | InChI=1S/C10H8Cl2F3N5S/c1-20-4-5(3-16-20)21-19-9-17-7(11)6(8(12)18-9)2-10(13,14)15/h3-4H,2H2,1H3,(H,17,18,19) |
| InChIKey | CZLVWNUWVPCPTJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|