C21H20Cl2F5N7OS — CID 163247766
4-chloro-6-[2-chloro-3-(4-methylpiperazin-1-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-amine (PubChem CID 163247766) has the molecular formula C21H20Cl2F5N7OS and a molecular weight of 584.40 g/mol. Its IUPAC name is 4-chloro-6-[2-chloro-3-(4-methylpiperazin-1-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-amine.
| Compound Name | 4-chloro-6-[2-chloro-3-(4-methylpiperazin-1-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 163247766 |
| Molecular Formula | C21H20Cl2F5N7OS |
| Molecular Weight | 584.40 g/mol |
| Exact Mass | 583.07 |
| IUPAC Name | 4-chloro-6-[2-chloro-3-(4-methylpiperazin-1-yl)phenoxy]-N-(1-methylpyrazol-4-yl)sulfanyl-5-(1,1,2,2,2-pentafluoroethyl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2cccc(Oc3nc(NSc4cnn(C)c4)nc(Cl)c3C(F)(F)C(F)(F)F)c2Cl)CC1 |
| InChI | InChI=1S/C21H20Cl2F5N7OS/c1-33-6-8-35(9-7-33)13-4-3-5-14(16(13)22)36-18-15(20(24,25)21(26,27)28)17(23)30-19(31-18)32-37-12-10-29-34(2)11-12/h3-5,10-11H,6-9H2,1-2H3,(H,30,31,32) |
| InChIKey | FRNWNLUQLZVDRG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.40 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|