C26H28ClN7OS — CID 163247840
4-(3-chloro-4-piperazin-1-ylphenoxy)-6-(2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine (PubChem CID 163247840) has the molecular formula C26H28ClN7OS and a molecular weight of 522.08 g/mol. Its IUPAC name is 4-(3-chloro-4-piperazin-1-ylphenoxy)-6-(2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine.
| Compound Name | 4-(3-chloro-4-piperazin-1-ylphenoxy)-6-(2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 163247840 |
| Molecular Formula | C26H28ClN7OS |
| Molecular Weight | 522.08 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 4-(3-chloro-4-piperazin-1-ylphenoxy)-6-(2,6-dimethylphenyl)-N-(1-methylpyrazol-4-yl)sulfanylpyrimidin-2-amine |
| SMILES | Cc1cccc(C)c1-c1cc(Oc2ccc(N3CCNCC3)c(Cl)c2)nc(NSc2cnn(C)c2)n1 |
| InChI | InChI=1S/C26H28ClN7OS/c1-17-5-4-6-18(2)25(17)22-14-24(31-26(30-22)32-36-20-15-29-33(3)16-20)35-19-7-8-23(21(27)13-19)34-11-9-28-10-12-34/h4-8,13-16,28H,9-12H2,1-3H3,(H,30,31,32) |
| InChIKey | DQOHHYOXLYDXKE-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.08 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|