C28H33N7O2S — CID 163247289
4-(2-butan-2-ylphenoxy)-N-(1-methylpyrazol-4-yl)sulfanyl-6-(4-piperazin-1-ylphenoxy)pyrimidin-2-amine (PubChem CID 163247289) has the molecular formula C28H33N7O2S and a molecular weight of 531.69 g/mol. Its IUPAC name is 4-(2-butan-2-ylphenoxy)-N-(1-methylpyrazol-4-yl)sulfanyl-6-(4-piperazin-1-ylphenoxy)pyrimidin-2-amine.
| Compound Name | 4-(2-butan-2-ylphenoxy)-N-(1-methylpyrazol-4-yl)sulfanyl-6-(4-piperazin-1-ylphenoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 163247289 |
| Molecular Formula | C28H33N7O2S |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | 4-(2-butan-2-ylphenoxy)-N-(1-methylpyrazol-4-yl)sulfanyl-6-(4-piperazin-1-ylphenoxy)pyrimidin-2-amine |
| SMILES | CCC(C)c1ccccc1Oc1cc(Oc2ccc(N3CCNCC3)cc2)nc(NSc2cnn(C)c2)n1 |
| InChI | InChI=1S/C28H33N7O2S/c1-4-20(2)24-7-5-6-8-25(24)37-27-17-26(31-28(32-27)33-38-23-18-30-34(3)19-23)36-22-11-9-21(10-12-22)35-15-13-29-14-16-35/h5-12,17-20,29H,4,13-16H2,1-3H3,(H,31,32,33) |
| InChIKey | PNFFSLDNLRSGKI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|