C30H35N7OS — CID 163247994
4-(2-cyclobutylphenyl)-5-ethyl-N-(1-methylpyrazol-4-yl)sulfanyl-6-(4-piperazin-1-ylphenoxy)pyrimidin-2-amine (PubChem CID 163247994) has the molecular formula C30H35N7OS and a molecular weight of 541.73 g/mol. Its IUPAC name is 4-(2-cyclobutylphenyl)-5-ethyl-N-(1-methylpyrazol-4-yl)sulfanyl-6-(4-piperazin-1-ylphenoxy)pyrimidin-2-amine.
| Compound Name | 4-(2-cyclobutylphenyl)-5-ethyl-N-(1-methylpyrazol-4-yl)sulfanyl-6-(4-piperazin-1-ylphenoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 163247994 |
| Molecular Formula | C30H35N7OS |
| Molecular Weight | 541.73 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 4-(2-cyclobutylphenyl)-5-ethyl-N-(1-methylpyrazol-4-yl)sulfanyl-6-(4-piperazin-1-ylphenoxy)pyrimidin-2-amine |
| SMILES | CCc1c(Oc2ccc(N3CCNCC3)cc2)nc(NSc2cnn(C)c2)nc1-c1ccccc1C1CCC1 |
| InChI | InChI=1S/C30H35N7OS/c1-3-25-28(27-10-5-4-9-26(27)21-7-6-8-21)33-30(35-39-24-19-32-36(2)20-24)34-29(25)38-23-13-11-22(12-14-23)37-17-15-31-16-18-37/h4-5,9-14,19-21,31H,3,6-8,15-18H2,1-2H3,(H,33,34,35) |
| InChIKey | OBJCUGAMJNZZFS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.73 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|