C31H34ClN5O3S — CID 163247280
3-amino-N-[4-[4-chloro-3-(1-methylpiperidin-4-yl)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-yl]benzenesulfonamide (PubChem CID 163247280) has the molecular formula C31H34ClN5O3S and a molecular weight of 592.17 g/mol. Its IUPAC name is 3-amino-N-[4-[4-chloro-3-(1-methylpiperidin-4-yl)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-yl]benzenesulfonamide.
| Compound Name | 3-amino-N-[4-[4-chloro-3-(1-methylpiperidin-4-yl)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 163247280 |
| Molecular Formula | C31H34ClN5O3S |
| Molecular Weight | 592.17 g/mol |
| Exact Mass | 591.21 |
| IUPAC Name | 3-amino-N-[4-[4-chloro-3-(1-methylpiperidin-4-yl)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-yl]benzenesulfonamide |
| SMILES | CC(C)c1ccccc1-c1cc(Oc2ccc(Cl)c(C3CCN(C)CC3)c2)nc(NS(=O)(=O)c2cccc(N)c2)n1 |
| InChI | InChI=1S/C31H34ClN5O3S/c1-20(2)25-9-4-5-10-26(25)29-19-30(35-31(34-29)36-41(38,39)24-8-6-7-22(33)17-24)40-23-11-12-28(32)27(18-23)21-13-15-37(3)16-14-21/h4-12,17-21H,13-16,33H2,1-3H3,(H,34,35,36) |
| InChIKey | BKDJPXNGZHGCOA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.17 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|