C27H29N5O3S — CID 163247259
3-amino-N-[4-[3-(dimethylamino)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-yl]benzenesulfonamide (PubChem CID 163247259) has the molecular formula C27H29N5O3S and a molecular weight of 503.63 g/mol. Its IUPAC name is 3-amino-N-[4-[3-(dimethylamino)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-yl]benzenesulfonamide.
| Compound Name | 3-amino-N-[4-[3-(dimethylamino)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 163247259 |
| Molecular Formula | C27H29N5O3S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 3-amino-N-[4-[3-(dimethylamino)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-yl]benzenesulfonamide |
| SMILES | CC(C)c1ccccc1-c1cc(Oc2cccc(N(C)C)c2)nc(NS(=O)(=O)c2cccc(N)c2)n1 |
| InChI | InChI=1S/C27H29N5O3S/c1-18(2)23-13-5-6-14-24(23)25-17-26(35-21-11-8-10-20(16-21)32(3)4)30-27(29-25)31-36(33,34)22-12-7-9-19(28)15-22/h5-18H,28H2,1-4H3,(H,29,30,31) |
| InChIKey | KJEVHPLDEOACPD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|