C27H29N5OS — CID 163248170
N-(3-aminophenyl)sulfanyl-4-[3-(dimethylamino)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-amine (PubChem CID 163248170) has the molecular formula C27H29N5OS and a molecular weight of 471.63 g/mol. Its IUPAC name is N-(3-aminophenyl)sulfanyl-4-[3-(dimethylamino)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-amine.
| Compound Name | N-(3-aminophenyl)sulfanyl-4-[3-(dimethylamino)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 163248170 |
| Molecular Formula | C27H29N5OS |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | N-(3-aminophenyl)sulfanyl-4-[3-(dimethylamino)phenoxy]-6-(2-propan-2-ylphenyl)pyrimidin-2-amine |
| SMILES | CC(C)c1ccccc1-c1cc(Oc2cccc(N(C)C)c2)nc(NSc2cccc(N)c2)n1 |
| InChI | InChI=1S/C27H29N5OS/c1-18(2)23-13-5-6-14-24(23)25-17-26(33-21-11-8-10-20(16-21)32(3)4)30-27(29-25)31-34-22-12-7-9-19(28)15-22/h5-18H,28H2,1-4H3,(H,29,30,31) |
| InChIKey | UDPPRXKAKNFLHV-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|