C29H32N4OS — CID 163247024
N-(3-aminophenyl)sulfanyl-4-(2-methylphenoxy)-5-propan-2-yl-6-(2-propan-2-ylphenyl)pyrimidin-2-amine (PubChem CID 163247024) has the molecular formula C29H32N4OS and a molecular weight of 484.67 g/mol. Its IUPAC name is N-(3-aminophenyl)sulfanyl-4-(2-methylphenoxy)-5-propan-2-yl-6-(2-propan-2-ylphenyl)pyrimidin-2-amine.
| Compound Name | N-(3-aminophenyl)sulfanyl-4-(2-methylphenoxy)-5-propan-2-yl-6-(2-propan-2-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 163247024 |
| Molecular Formula | C29H32N4OS |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N-(3-aminophenyl)sulfanyl-4-(2-methylphenoxy)-5-propan-2-yl-6-(2-propan-2-ylphenyl)pyrimidin-2-amine |
| SMILES | Cc1ccccc1Oc1nc(NSc2cccc(N)c2)nc(-c2ccccc2C(C)C)c1C(C)C |
| InChI | InChI=1S/C29H32N4OS/c1-18(2)23-14-7-8-15-24(23)27-26(19(3)4)28(34-25-16-9-6-11-20(25)5)32-29(31-27)33-35-22-13-10-12-21(30)17-22/h6-19H,30H2,1-5H3,(H,31,32,33) |
| InChIKey | LZUQLCXRTVWTLX-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|